ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96-04-8 2,3-heptanedione |
|
Naam product | 2,3-heptanedione |
Engelse naam | 2,3-heptanedione;2,3-Heptanedione;Acetyl pentanoyl;Acetyl valeryl;FEMA No. 2543;NSC 31668;UNII-DK55DDE86P;Valerylacetyl;heptane-2,3-dione |
MF | C7H12O2 |
Molecuulgewicht | 128.169 |
InChI | InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
CAS-nummer | 96-04-8 |
EINECS | 202-472-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 0.926g/cm3 |
Kookpunt | 149.7°C at 760 mmHg |
Brekingsindex | 1.413 |
Vlampunt | 45°C |
Dampdruk | 3.98mmHg at 25°C |
Risico-codes | R10##Flammable.:; |
Veiligheid Omschrijving | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |