ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95727-77-8 2,6-difluorutyrofenon |
|
Naam product | 2,6-difluorutyrofenon |
Synoniemen | 1-(2,6-difluorfenyl)butaan-1-on; |
Engelse naam | 2,6-Difluorobutyrophenone;1-(2,6-difluorophenyl)butan-1-one |
MF | C10H10F2O |
Molecuulgewicht | 184.1826 |
InChI | InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
CAS-nummer | 95727-77-8 |
Moleculaire Structuur | |
Dichtheid | 1.134g/cm3 |
Kookpunt | 219.6°C at 760 mmHg |
Brekingsindex | 1.472 |
Vlampunt | 82.6°C |
Dampdruk | 0.118mmHg at 25°C |
Risico-codes | R36/38##Irritating to eyes and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |