Chemindex > 95-12-5
NL â–¼
95-12-5 5-Norbornene-2-methanol |
|
| Naam product | 5-Norbornene-2-methanol |
| Engelse naam | 5-Norbornene-2-methanol;5-Norbornene-2-methanol,mixture of endo and exo;2-Hydroxymethyl-5-norbornene;5-Norborene-2-methanol;5-norbornene-2-methanol(NMO)mixture of endo and exo;bicyclo[2.2.1]hept-5-en-2-ylmethanol;(1R,2S,4R)-bicyclo[2.2.1]hept-5-en-2-ylmethanol |
| MF | C8H12O |
| Molecuulgewicht | 124.1803 |
| InChI | InChI=1/C8H12O/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2/t6-,7+,8-/m1/s1 |
| CAS-nummer | 95-12-5 |
| EINECS | 202-392-0 |
| Moleculaire Structuur |  |
| Dichtheid | 1.06g/cm3 |
| Kookpunt | 189.2°C at 760 mmHg |
| Brekingsindex | 1.53 |
| Vlampunt | 81.6°C |
| Dampdruk | 0.158mmHg at 25°C |
| Gevaarsymbolen |  Xn##Harmful:; |
| Risico-codes | R20/21/22:; |
| Veiligheid Omschrijving | S36/37/39||S45:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 