ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94978-86-6 3-cyano-6,7-dimethylchromon |
|
Naam product | 3-cyano-6,7-dimethylchromon |
Synoniemen | 6,7-dimethyl-4-oxo-4H-1-benzopyran-3-carbonitril; 6,7-dimethyl-4-oxo-4H-chroom-3-carbonitril; |
Engelse naam | 3-cyano-6,7-dimethylchromone;6,7-Dimethyl-4-oxo-4H-1-benzopyran-3-carbonitrile;6,7-dimethyl-4-oxo-4H-chromene-3-carbonitrile |
MF | C12H9NO2 |
Molecuulgewicht | 199.2054 |
InChI | InChI=1/C12H9NO2/c1-7-3-10-11(4-8(7)2)15-6-9(5-13)12(10)14/h3-4,6H,1-2H3 |
CAS-nummer | 94978-86-6 |
Moleculaire Structuur | |
Dichtheid | 1.25g/cm3 |
Smeltpunt | 206-209℃ |
Kookpunt | 347.8°C at 760 mmHg |
Brekingsindex | 1.594 |
Vlampunt | 151.8°C |
Dampdruk | 5.26E-05mmHg at 25°C |
Gevaarsymbolen | Xn##Harmful:; |
Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |