ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94023-55-9 N-(2-carboxyethyl)-N-dodecyl-β-alanine, verbinding met methylamine (1:1) |
|
Naam product | N-(2-carboxyethyl)-N-dodecyl-β-alanine, verbinding met methylamine (1:1) |
Synoniemen | N-(2-carboxyethyl)-N-dodecyl-bèta-alanine, verbinding met methylamine (1:1); 3-(2-carboxyethyl-dodecyl-amino)propaanzuur; methanamine; |
Engelse naam | N-(2-carboxyethyl)-N-dodecyl-β-alanine, compound with methylamine (1:1);N-(2-Carboxyethyl)-N-dodecyl-beta-alanine, compound with methylamine (1:1);3-(2-carboxyethyl-dodecyl-amino)propanoic acid; methanamine |
MF | C19H40N2O4 |
Molecuulgewicht | 360.5319 |
InChI | InChI=1/C18H35NO4.CH5N/c1-2-3-4-5-6-7-8-9-10-11-14-19(15-12-17(20)21)16-13-18(22)23;1-2/h2-16H2,1H3,(H,20,21)(H,22,23);2H2,1H3 |
CAS-nummer | 94023-55-9 |
EINECS | 301-653-7 |
Moleculaire Structuur | |
Kookpunt | 517.7°C at 760 mmHg |
Vlampunt | 266.9°C |
Dampdruk | 4.15E-12mmHg at 25°C |
MSDS |