ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
93-58-3 Methyl benzoate |
|
Naam product | Methyl benzoate |
Engelse naam | Methyl benzoate;Benzoic acid methyl ester;clorius;essence of niobe;methyl benzenecarboxylate;Niobe oil;Oil of niobe;oniobe oil;oxidate le |
MF | C8H8O2 |
Molecuulgewicht | 136.1479 |
InChI | InChI=1/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3 |
CAS-nummer | 93-58-3 |
EINECS | 202-259-7 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.069g/cm3 |
Smeltpunt | -12℃ |
Kookpunt | 199.5°C at 760 mmHg |
Brekingsindex | 1.509 |
Vlampunt | 80.2°C |
Oplosbaarheid in water | <0.1 g/100 mL at 22.5℃ |
Dampdruk | 0.34mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R22:; |
Veiligheid Omschrijving | S36:; |
MSDS |