ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Phenylpropionaldehyde |
|
Naam product | 2-Phenylpropionaldehyde |
Engelse naam | 2-Phenylpropionaldehyde;2-Phenylpropanal;alpha-methylphenylacetaldehyde;hydratopic aldehyde;Hydratropic aldehyde |
MF | C9H10O |
Molecuulgewicht | 134.1751 |
InChI | InChI=1/C9H10O/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3 |
CAS-nummer | 93-53-8 |
EINECS | 202-255-5 |
Moleculaire Structuur | |
Dichtheid | 0.98g/cm3 |
Kookpunt | 202.3°C at 760 mmHg |
Brekingsindex | 1.505 |
Vlampunt | 76.1°C |
Dampdruk | 0.294mmHg at 25°C |
Risico-codes | R36/38##Irritating to eyes and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |