ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3-Nonanone |
|
Naam product | 3-Nonanone |
Engelse naam | 3-Nonanone;Ethyl n-hexyl ketone;nonan-3-one |
MF | C9H18O |
Molecuulgewicht | 142.2386 |
InChI | InChI=1/C9H18O/c1-3-5-6-7-8-9(10)4-2/h3-8H2,1-2H3 |
CAS-nummer | 925-78-0 |
EINECS | 213-125-2 |
Moleculaire Structuur | |
Dichtheid | 0.816g/cm3 |
Smeltpunt | -8℃ |
Kookpunt | 190.1°C at 760 mmHg |
Brekingsindex | 1.416 |
Vlampunt | 67.8°C |
Dampdruk | 0.551mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |