ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
92-46-6 6-Chloro-2-methylquinoline |
|
Naam product | 6-Chloro-2-methylquinoline |
Engelse naam | 6-Chloro-2-methylquinoline;6-Chloroquinaldine;2-Methyl-6-chloroquinoline |
MF | C10H8ClN |
Molecuulgewicht | 177.6302 |
InChI | InChI=1/C10H8ClN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-6H,1H3 |
CAS-nummer | 92-46-6 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.225g/cm3 |
Kookpunt | 278.2°C at 760 mmHg |
Brekingsindex | 1.634 |
Vlampunt | 148.7°C |
Dampdruk | 0.00732mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |