ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
909-84-2 6,7-bis(benzyloxy)cumarine |
|
Naam product | 6,7-bis(benzyloxy)cumarine |
Synoniemen | Esculetin-dibenzyletether; 6,7-bis(benzyloxy)-2H-chromen-2-on; |
Engelse naam | 6,7-Bis(benzyloxy)coumarin;Esculetin dibenzyl ether;6,7-bis(benzyloxy)-2H-chromen-2-one |
MF | C23H18O4 |
Molecuulgewicht | 358.3866 |
InChI | InChI=1/C23H18O4/c24-23-12-11-19-13-21(25-15-17-7-3-1-4-8-17)22(14-20(19)27-23)26-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
CAS-nummer | 909-84-2 |
EINECS | 213-003-9 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.25g/cm3 |
Kookpunt | 560.2°C at 760 mmHg |
Brekingsindex | 1.631 |
Vlampunt | 246°C |
Dampdruk | 1.4E-12mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |