ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
905-62-4 2,5-Bis(1-naphthyl)-1,3,4-oxadiazole |
|
Naam product | 2,5-Bis(1-naphthyl)-1,3,4-oxadiazole |
Engelse naam | 2,5-Bis(1-naphthyl)-1,3,4-oxadiazole;2,5-Di(1-naphthyl)-1,3,4-oxadiazole;2,5-di(naphthalen-1-yl)-1,3,4-oxadiazole |
MF | C22H14N2O |
Molecuulgewicht | 322.3594 |
InChI | InChI=1/C22H14N2O/c1-3-11-17-15(7-1)9-5-13-19(17)21-23-24-22(25-21)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
CAS-nummer | 905-62-4 |
EINECS | 212-995-0 |
Moleculaire Structuur | |
Dichtheid | 1.251g/cm3 |
Kookpunt | 556.4°C at 760 mmHg |
Brekingsindex | 1.7 |
Vlampunt | 293.1°C |
Dampdruk | 7.55E-12mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |