ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
90438-79-2 acetic acid, alkyl (C6 to C8) esters mixture |
|
Naam product | acetic acid, alkyl (C6 to C8) esters mixture |
Engelse naam | acetic acid, alkyl (C6 to C8) esters mixture;Acetic acid, C6-8-branched alkyl esters;5-methylhexyl acetate |
MF | C9H18O2 |
Molecuulgewicht | 158.238 |
InChI | InChI=1/C9H18O2/c1-8(2)6-4-5-7-11-9(3)10/h8H,4-7H2,1-3H3 |
CAS-nummer | 90438-79-2 |
Moleculaire Structuur | |
Dichtheid | 0.874g/cm3 |
Kookpunt | 176.486°C at 760 mmHg |
Brekingsindex | 1.417 |
Vlampunt | 59.352°C |
Dampdruk | 1.09mmHg at 25°C |
MSDS |