ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
90-90-4 4-Bromobenzophenone |
|
Naam product | 4-Bromobenzophenone |
Engelse naam | 4-Bromobenzophenone;Benzophenone, 4-bromo-;4-07-00-01378 (Beilstein Handbook Reference);4-Bromophenyl phenyl ketone;BRN 1910182;NSC 59863;USAF DO-3;p-Benzoylbromobenzene;p-Bromobenzophenone;Methanone, (4-bromophenyl)phenyl-;Methanone, (4-bromophenyl)phenyl- (9CI);(4-bromophenyl)(phenyl)methanone |
MF | C13H9BrO |
Molecuulgewicht | 261.114 |
InChI | InChI=1/C13H9BrO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H |
CAS-nummer | 90-90-4 |
EINECS | 202-024-9 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.421g/cm3 |
Smeltpunt | 78-82℃ |
Kookpunt | 346.8°C at 760 mmHg |
Brekingsindex | 1.61 |
Vlampunt | 81.3°C |
Dampdruk | 5.62E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |