ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88634-80-4 2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde |
|
Naam product | 2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde |
Engelse naam | 2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde;2-ethyl-5-methyl-1H-imidazole-4-carbaldehyde |
MF | C7H10N2O |
Molecuulgewicht | 138.1671 |
InChI | InChI=1/C7H10N2O/c1-3-7-8-5(2)6(4-10)9-7/h4H,3H2,1-2H3,(H,8,9) |
CAS-nummer | 88634-80-4 |
Moleculaire Structuur | |
Dichtheid | 1.134g/cm3 |
Smeltpunt | 104℃ |
Kookpunt | 360.8°C at 760 mmHg |
Brekingsindex | 1.569 |
Vlampunt | 175.8°C |
Dampdruk | 2.16E-05mmHg at 25°C |
Gevaarsymbolen | Xi##Irritant:; |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |