Chemindex > 88-96-0
NL ▼
88-96-0 Phthalamide |
|
| Naam product | Phthalamide |
| Engelse naam | Phthalamide;1,2-Benzenedicarboxamide;4-09-00-03265 (Beilstein Handbook Reference);AI3-03746;BRN 1868220;CCRIS 518;HSDB 4087;NCI-C03612;NSC 5512;P-D;Phthaldiamide;Phthalic acid diamide;o-Carbamoylbenzamide;o-Phthalic acid diamide;benzene-1,2-dicarboxamide |
| MF | C8H8N2O2 |
| Molecuulgewicht | 164.1613 |
| InChI | InChI=1/C8H8N2O2/c9-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H,(H2,9,11)(H2,10,12) |
| CAS-nummer | 88-96-0 |
| EINECS | 201-870-6 |
| Moleculaire Structuur |  |
| Dichtheid | 1.294g/cm3 |
| Kookpunt | 430.8°C at 760 mmHg |
| Brekingsindex | 1.612 |
| Vlampunt | 214.4°C |
| Dampdruk | 1.26E-07mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Bezoek ChemNet Mall om te informeren naar de prijs van
Phthalamide 88-96-0
Chemical CAS Database Service wordt geleverd door ChemIndex.com 