ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-dichloro-3-nitrobenzoic acid |
|
Naam product | 2,5-dichloro-3-nitrobenzoic acid |
Engelse naam | 2,5-dichloro-3-nitrobenzoic acid;Benzoic acid, 2,5-dichloro-3-nitro-;2,5-Dichloro-3-nitrobenzoic acid;2,5-Dichloro-4-nitrobenzoic acid;2-09-00-00276 (Beilstein Handbook Reference);3-Nitro-2,5-dichlorobenzoic acid;BRN 1976119;Caswell No. 312;Dinoben;EPA Pesticide Chemical Code 028101;Kyselina 2,5-dichlor-3-nitrobenzoova;Kyselina 2,5-dichlor-3-nitrobenzoova [Czech] |
MF | C7H3Cl2NO4 |
Molecuulgewicht | 236.009 |
InChI | InChI=1/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
CAS-nummer | 88-86-8 |
EINECS | 201-862-2 |
Moleculaire Structuur | |
Dichtheid | 1.713g/cm3 |
Smeltpunt | 216-220℃ |
Kookpunt | 366.5°C at 760 mmHg |
Brekingsindex | 1.638 |
Vlampunt | 175.5°C |
Dampdruk | 5.11E-06mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |