ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Hexamethylbenzene |
|
Naam product | Hexamethylbenzene |
Engelse naam | Hexamethylbenzene;Mellitene |
MF | C12H18 |
Molecuulgewicht | 162.2713 |
InChI | InChI=1/C12H18/c1-7-8(2)10(4)12(6)11(5)9(7)3/h1-6H3 |
CAS-nummer | 87-85-4 |
EINECS | 201-777-0 |
Moleculaire Structuur | |
Dichtheid | 0.867g/cm3 |
Smeltpunt | 165-168℃ |
Kookpunt | 256.6°C at 760 mmHg |
Brekingsindex | 1.501 |
Vlampunt | 104.3°C |
Dampdruk | 0.0245mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |