ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-82-1 Hexabromobenzene |
|
Naam product | Hexabromobenzene |
Engelse naam | Hexabromobenzene;AI3-60220;CCRIS 5917;HSDB 2912;NSC 113975;Benzene, 1,2,3,4,5,6-hexabromo-;Benzene, hexabromo- |
MF | C6Br6 |
Molecuulgewicht | 551.49 |
InChI | InChI=1/C6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
CAS-nummer | 87-82-1 |
EINECS | 201-773-9 |
Moleculaire Structuur | |
Smeltpunt | 326-327℃ |
Gevaarsymbolen | Xi##Irritant:; |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |