Chemindex > 86-26-0
NL ▼
86-26-0 2-Methoxybiphenyl |
|
| Naam product | 2-Methoxybiphenyl |
| Engelse naam | 2-Methoxybiphenyl;2-Phenylanisole;biphenyl-2-yl methyl ether;o-Methoxybiphenyl |
| MF | C13H12O |
| Molecuulgewicht | 184.2338 |
| InChI | InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS-nummer | 86-26-0 |
| EINECS | 201-659-9 |
| Moleculaire Structuur |  |
| Dichtheid | 1.03g/cm3 |
| Smeltpunt | 30-33℃ |
| Kookpunt | 274°C at 760 mmHg |
| Brekingsindex | 1.556 |
| Vlampunt | 101.3°C |
| Dampdruk | 0.00928mmHg at 25°C |
| Gevaarsymbolen |  Xn##Harmful:; |
| Risico-codes | R33##Danger of cummulative effects.:; |
| Veiligheid Omschrijving | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 