ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-55-2 2-(4-Methylbenzoyl)benzoic acid |
|
Naam product | 2-(4-Methylbenzoyl)benzoic acid |
Engelse naam | 2-(4-Methylbenzoyl)benzoic acid;2-(p-Toluoyl)benzoic acid;4-Methylbenzophenone-2-carboxylic acid;2-[(4-methylphenyl)carbonyl]benzoate |
MF | C15H11O3 |
Molecuulgewicht | 239.2466 |
InChI | InChI=1/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18)/p-1 |
CAS-nummer | 85-55-2 |
EINECS | 201-614-3 |
Moleculaire Structuur | |
Smeltpunt | 137-139℃ |
Kookpunt | 457.1°C at 760 mmHg |
Vlampunt | 244.3°C |
Dampdruk | 3.79E-09mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |