Chemindex > 85-02-9
NL ▼
85-02-9 5,6-Benzoquinoline |
|
| Naam product | 5,6-Benzoquinoline |
| Engelse naam | 5,6-Benzoquinoline;beta-Naphthoquinoline;1-Azaphenanthrene;Benzo[f]quinoline;Benzoquinoline;benzo(f)quinoline |
| MF | C13H9N |
| Molecuulgewicht | 179.2173 |
| InChI | InChI=1/C13H9N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h1-9H |
| CAS-nummer | 85-02-9 |
| EINECS | 201-582-0 |
| Moleculaire Structuur |  |
| Dichtheid | 1.187g/cm3 |
| Smeltpunt | 89-91℃ |
| Kookpunt | 350.4°C at 760 mmHg |
| Brekingsindex | 1.726 |
| Vlampunt | 155.9°C |
| Dampdruk | 8.89E-05mmHg at 25°C |
| Gevaarsymbolen |  Xn##Harmful:; |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.||R40##Possible risks of irreversible effects.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 