ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
|
Naam product | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
Engelse naam | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde;1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-;NSC 68230;2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde;Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde;2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
MF | C13H19NO |
Molecuulgewicht | 205.2961 |
InChI | InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
CAS-nummer | 83-18-1 |
EINECS | 201-458-6 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.07g/cm3 |
Kookpunt | 345.8°C at 760 mmHg |
Brekingsindex | 1.559 |
Vlampunt | 163°C |
Dampdruk | 6E-05mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |