ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
825-51-4 Decahydro-2-naphthol, mixture of isomers |
|
Naam product | Decahydro-2-naphthol, mixture of isomers |
Engelse naam | Decahydro-2-naphthol, mixture of isomers;Decahydro-2-naphthol;decahydronaphthalen-2-ol;(2R,4aR,8aR)-decahydronaphthalen-2-ol;(2R,4aS,8aS)-decahydronaphthalen-2-ol;(2S,4aS,8aS)-decahydronaphthalen-2-ol;(2R,4aS,8aR)-decahydronaphthalen-2-ol;(2S,4aS,8aR)-decahydronaphthalen-2-ol |
MF | C10H18O |
Molecuulgewicht | 154.2493 |
InChI | InChI=1/C10H18O/c11-10-6-5-8-3-1-2-4-9(8)7-10/h8-11H,1-7H2/t8-,9+,10-/m0/s1 |
CAS-nummer | 825-51-4 |
EINECS | 212-545-3 |
Moleculaire Structuur | |
Dichtheid | 0.993g/cm3 |
Kookpunt | 211.594°C at 760 mmHg |
Brekingsindex | 1.501 |
Vlampunt | 102.148°C |
Dampdruk | 0.041mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |