ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
825-03-6 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid |
|
Naam product | 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid |
Engelse naam | 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid;2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid;5-Methyl-2-norbornene-5-carboxylic Acid;(1S,2S,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate;(1S,2R,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
MF | C9H11O2 |
Molecuulgewicht | 151.183 |
InChI | InChI=1/C9H12O2/c1-9(8(10)11)5-6-2-3-7(9)4-6/h2-3,6-7H,4-5H2,1H3,(H,10,11)/p-1/t6-,7-,9-/m1/s1 |
CAS-nummer | 825-03-6 |
Moleculaire Structuur | |
Smeltpunt | 83℃ |
Kookpunt | 261.352°C at 760 mmHg |
Vlampunt | 121.096°C |
Dampdruk | 0.003mmHg at 25°C |
Gevaarsymbolen | Xi##Irritant:; |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |