ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Sodium 4-nitrophenoxide, hydrate |
|
Naam product | Sodium 4-nitrophenoxide, hydrate |
Engelse naam | Sodium 4-nitrophenoxide, hydrate;4-Nitrophenol sodium salt;sodium p-nitrophenolate;4-Nitropheol Sodium Salt;P-Nitro phenol sodium salt;Sodium 4-nitrophenoxide;sodium 4-nitrophenolate |
MF | C6H4NNaO3 |
Molecuulgewicht | 161.0906 |
InChI | InChI=1/C6H5NO3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H;/q;+1/p-1 |
CAS-nummer | 824-78-2 |
EINECS | 212-536-4 |
Moleculaire Structuur | |
Smeltpunt | 300℃ |
Kookpunt | 279°C at 760 mmHg |
Vlampunt | 141.9°C |
Dampdruk | 0.00243mmHg at 25°C |
Gevaarsymbolen | Xn##Harmful:; |
Risico-codes | R20/21/22||R33:; |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |