ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
823-22-3 delta-Hexanolactone |
|
Naam product | delta-Hexanolactone |
Engelse naam | delta-Hexanolactone;delta-Hexalactone;5-Hydroxyhexanoic acid lactone;6-methyltetrahydro-2H-pyran-2-one;(6S)-6-methyltetrahydro-2H-pyran-2-one |
MF | C6H10O2 |
Molecuulgewicht | 114.1424 |
InChI | InChI=1/C6H10O2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m0/s1 |
CAS-nummer | 823-22-3 |
EINECS | 212-511-8 |
Moleculaire Structuur | |
Dichtheid | 1.001g/cm3 |
Kookpunt | 215.7°C at 760 mmHg |
Brekingsindex | 1.43 |
Vlampunt | 79.8°C |
Dampdruk | 0.145mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |