ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1,5-Dichloroanthraquinone |
|
Naam product | 1,5-Dichloroanthraquinone |
Engelse naam | 1,5-Dichloroanthraquinone;1,5-Dichloranthrachinon;1,5-Dichloranthrachinon [Czech];1,5-Dichloro-9,10-anthraquinone;9,10-Anthracenedione, 1,5-dichloro-;AI3-38301;NSC 13969;Anthraquinone, 1,5-dichloro-;1,5-dichloroanthracene-9,10-dione;1,5-Dichloro Anthraquinone |
MF | C14H6Cl2O2 |
Molecuulgewicht | 277.1022 |
InChI | InChI=1/C14H6Cl2O2/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6H |
CAS-nummer | 82-46-2 |
EINECS | 201-424-0 |
Moleculaire Structuur | |
Dichtheid | 1.514g/cm3 |
Smeltpunt | 245-250℃ |
Kookpunt | 455.2°C at 760 mmHg |
Brekingsindex | 1.671 |
Vlampunt | 191.7°C |
Dampdruk | 1.79E-08mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |