ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
815-82-7 Cupric Tartrate |
|
Naam product | Cupric Tartrate |
Engelse naam | Cupric Tartrate;Copper(II) tartrate hydrate;Coppertartratehydratebluegreenxtl;Tartaric acid cupric salt;copper(2+) (2R,3R)-2,3-dihydroxybutanedioate |
MF | C4H4CuO6 |
Molecuulgewicht | 211.617 |
InChI | InChI=1/C4H6O6.Cu/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2/t1-,2-;/m1./s1 |
CAS-nummer | 815-82-7;17263-56-8 |
EINECS | 212-425-0 |
Moleculaire Structuur | |
Kookpunt | 399.3°C at 760 mmHg |
Vlampunt | 209.4°C |
Oplosbaarheid in water | slightly soluble |
Dampdruk | 4.93E-08mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |