ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
815-68-9 Triacetylmethane |
|
Naam product | Triacetylmethane |
Engelse naam | Triacetylmethane;methine triacetate;3-acetylpentane-2,4-dione;3-(1-hydroxyethylidene)pentane-2,4-dione |
MF | C7H10O3 |
Molecuulgewicht | 142.1525 |
InChI | InChI=1/C7H10O3/c1-4(8)7(5(2)9)6(3)10/h8H,1-3H3 |
CAS-nummer | 815-68-9 |
EINECS | 212-422-4 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.101g/cm3 |
Kookpunt | 298.3°C at 760 mmHg |
Brekingsindex | 1.467 |
Vlampunt | 148.4°C |
Dampdruk | 0.000129mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |