ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
N-bromoacetamide |
|
Naam product | N-bromoacetamide |
Engelse naam | N-bromoacetamide;N-Bromoacetamide;CCRIS 4590;Acetamide, N-bromo- |
MF | C2H4BrNO |
Molecuulgewicht | 137.9633 |
InChI | InChI=1/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
CAS-nummer | 79-15-2 |
EINECS | 201-181-0 |
Moleculaire Structuur | |
Dichtheid | 1.71g/cm3 |
Brekingsindex | 1.474 |
Risico-codes | R34##Causes burns.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |