ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-79-2 Butadiene sulfone |
|
Naam product | Butadiene sulfone |
Engelse naam | Butadiene sulfone;2,5-Dihydrothiophene-1,1-dioxide;3-Sulfolene;Dihydrothiophene-1,1-dioxide;Butadiene sulphone;Cyclobutenesulfone |
MF | C4H6O2S |
Molecuulgewicht | 118.15 |
InChI | InChI=1/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
CAS-nummer | 77-79-2 |
EINECS | 201-059-7 |
Moleculaire Structuur | |
Dichtheid | 1.314 |
Smeltpunt | 63-66℃ |
Vlampunt | 112℃ |
Gevaarsymbolen | Xi##Irritant:; |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |