ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76-54-0 2',7'-Dichlorofluorescein |
|
Naam product | 2',7'-Dichlorofluorescein |
Engelse naam | 2',7'-Dichlorofluorescein; |
MF | C20H10Cl2O5 |
Molecuulgewicht | 401.1964 |
InChI | InChI=1/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)27-18-8-16(24)14(22)6-12(18)19(11)9-3-1-2-4-10(9)20(25)26/h1-8,23H,(H,25,26) |
CAS-nummer | 76-54-0 |
EINECS | 200-968-6 |
Moleculaire Structuur | |
Dichtheid | 1.68g/cm3 |
Smeltpunt | 280℃ |
Kookpunt | 670.7°C at 760 mmHg |
Brekingsindex | 1.757 |
Vlampunt | 359.4°C |
Dampdruk | 6.63E-19mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |