ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-39-8 Aceetaldehyde ammoniak trimeer |
|
Naam product | Aceetaldehyde ammoniak trimeer |
Synoniemen | hexahydro-2,4,6-trimethyl-s-triazinetrihydraat; Aceetaldehyde ammoniak trimeer,; aceetaldehyde-ammoniak; 1-aminoethanol; aceetaldehyde ammoniak (1:1); |
Engelse naam | Acetaldehyde ammonia trimer;Hexahydro-2,4,6-trimethyl-s-triazine trihydrate;Acetaldehyde ammonia trimer,;Acetaldehyde-Ammonia;1-aminoethanol;acetaldehyde ammoniate (1:1) |
MF | C2H7NO |
Molecuulgewicht | 61.0831 |
InChI | InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
CAS-nummer | 75-39-8 |
EINECS | 200-868-2 |
Moleculaire Structuur | ![]() |
Dichtheid | 0.967g/cm3 |
Smeltpunt | 95-97℃ |
Kookpunt | 113.8°C at 760 mmHg |
Brekingsindex | 1.431 |
Vlampunt | 22.7°C |
Dampdruk | 10.4mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |