Chemindex > 75-27-4
NL ▼
75-27-4 Bromodichloromethane |
|
| Naam product | Bromodichloromethane |
| Engelse naam | Bromodichloromethane;FC-20B1 |
| MF | CHBrCl2 |
| Molecuulgewicht | 163.8286 |
| InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS-nummer | 75-27-4 |
| EINECS | 200-856-7 |
| Moleculaire Structuur |  |
| Dichtheid | 2.013g/cm3 |
| Smeltpunt | -55℃ |
| Kookpunt | 89.7°C at 760 mmHg |
| Brekingsindex | 1.503 |
| Vlampunt | 1.3°C |
| Dampdruk | 65.3mmHg at 25°C |
| Gevaarsymbolen |  Xn##Harmful:; |
| Risico-codes | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
| Veiligheid Omschrijving | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 