ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
Naam product | Bromodichloromethane |
Engelse naam | Bromodichloromethane;FC-20B1 |
MF | CHBrCl2 |
Molecuulgewicht | 163.8286 |
InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS-nummer | 75-27-4 |
EINECS | 200-856-7 |
Moleculaire Structuur | ![]() |
Dichtheid | 2.013g/cm3 |
Smeltpunt | -55℃ |
Kookpunt | 89.7°C at 760 mmHg |
Brekingsindex | 1.503 |
Vlampunt | 1.3°C |
Dampdruk | 65.3mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
Veiligheid Omschrijving | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |