ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
720-75-2 Methyl 4-biphenylcarboxylate |
|
Naam product | Methyl 4-biphenylcarboxylate |
Engelse naam | Methyl 4-biphenylcarboxylate;P-phenylbenzoic acid methyl ester;p-Phenylbenzoic acid-OMe;Methyl 4-Phenylbenzoate;4-Biphenylcarboxylic acid methyl ester~Methyl 4-phenylbenzoate;methyl biphenyl-4-carboxylate;methyl 4-phenylcyclohexanecarboxylate |
MF | C14H18O2 |
Molecuulgewicht | 218.2915 |
InChI | InChI=1/C14H18O2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
CAS-nummer | 720-75-2 |
EINECS | 211-954-4 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.048g/cm3 |
Smeltpunt | 118℃ |
Kookpunt | 307.8°C at 760 mmHg |
Brekingsindex | 1.517 |
Vlampunt | 132.7°C |
Dampdruk | 0.000709mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |