ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
10-Methyl-9(10H)-acridone |
|
Naam product | 10-Methyl-9(10H)-acridone |
Engelse naam | 10-Methyl-9(10H)-acridone;10-methylacridin-9(10H)-one;Methylacridone;N-Methylacridone |
MF | C14H11NO |
Molecuulgewicht | 209.2432 |
InChI | InChI=1/C14H11NO/c1-15-12-8-4-2-6-10(12)14(16)11-7-3-5-9-13(11)15/h2-9H,1H3 |
CAS-nummer | 719-54-0 |
EINECS | 211-948-1 |
Moleculaire Structuur | |
Dichtheid | 1.205g/cm3 |
Smeltpunt | 204-207℃ |
Kookpunt | 361.3°C at 760 mmHg |
Brekingsindex | 1.635 |
Vlampunt | 146.2°C |
Dampdruk | 2.09E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |