ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
716-53-0 9-chloroanthracene |
|
Naam product | 9-chloroanthracene |
Engelse naam | 9-chloroanthracene;Anthracene, 9-chloro-;9-Chloroanthracene;CCRIS 5547 |
MF | C14H9Cl |
Molecuulgewicht | 212.6743 |
InChI | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
CAS-nummer | 716-53-0 |
EINECS | 211-937-1 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.253g/cm3 |
Smeltpunt | 103-103℃ |
Kookpunt | 370.1°C at 760 mmHg |
Brekingsindex | 1.717 |
Vlampunt | 179.2°C |
Dampdruk | 2.42E-05mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |