ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
712-97-0 6-Nitropiperonal |
|
Naam product | 6-Nitropiperonal |
Engelse naam | 6-Nitropiperonal;(3,4-Methylenedioxy-6-nitrobenzald;4,5-Methylenedioxy-2-nitrobenzaldehyde;6-Nitro-1,3-benzodioxole-5-carboxaldehyde;6-nitro-1,3-benzodioxole-5-carbaldehyde;4,5-(Methylenedioxy)-2-nitrobenzaldehyde |
MF | C8H5NO5 |
Molecuulgewicht | 195.129 |
InChI | InChI=1/C8H5NO5/c10-3-5-1-7-8(14-4-13-7)2-6(5)9(11)12/h1-3H,4H2 |
CAS-nummer | 712-97-0 |
EINECS | 211-926-1 |
Moleculaire Structuur | |
Dichtheid | 1.572g/cm3 |
Smeltpunt | 93-96℃ |
Kookpunt | 365.9°C at 760 mmHg |
Brekingsindex | 1.658 |
Vlampunt | 195°C |
Dampdruk | 1.52E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |