ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
711-79-5 2-Acetyl-1-naphthol |
|
Naam product | 2-Acetyl-1-naphthol |
Engelse naam | 2-Acetyl-1-naphthol;1-Hydroxy-2-acetonaphthone;2-Acetyl-1-hydroxynaphthalene |
MF | C12H10O2 |
Molecuulgewicht | 186.2066 |
InChI | InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
CAS-nummer | 711-79-5 |
EINECS | 211-918-8 |
Moleculaire Structuur | |
Dichtheid | 1.213g/cm3 |
Smeltpunt | 97-100℃ |
Kookpunt | 334.9°C at 760 mmHg |
Brekingsindex | 1.65 |
Vlampunt | 142.4°C |
Dampdruk | 6.37E-05mmHg at 25°C |
Gevaarsymbolen | Xi##Irritant:; |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |