ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
700-44-7 6-Methoxysalicylaldehyde |
|
Naam product | 6-Methoxysalicylaldehyde |
Engelse naam | 6-Methoxysalicylaldehyde;2-Hydroxy-6-methoxybenzaldehyde;6-Hydroxy-o-anisaldehyde;2-hydroxy-6-methoxy benzaldehyde |
MF | C8H8O3 |
Molecuulgewicht | 152.1473 |
InChI | InChI=1/C8H8O3/c1-11-8-4-2-3-7(10)6(8)5-9/h2-5,10H,1H3 |
CAS-nummer | 700-44-7 |
EINECS | 211-844-6 |
Moleculaire Structuur | |
Dichtheid | 1.231g/cm3 |
Kookpunt | 262.9°C at 760 mmHg |
Brekingsindex | 1.587 |
Vlampunt | 107.8°C |
Dampdruk | 0.00651mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |