Chemindex > 70-69-9
NL ▼
70-69-9 4'-Aminopropiophenone |
|
| Naam product | 4'-Aminopropiophenone |
| Engelse naam | 4'-Aminopropiophenone;4-Aminopropiophenone;para-Aminopropiophenone;p-Aminopropiophenone |
| MF | C9H11NO |
| Molecuulgewicht | 149.1897 |
| InChI | InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| CAS-nummer | 70-69-9 |
| EINECS | 200-742-7 |
| Moleculaire Structuur |  |
| Dichtheid | 1.067g/cm3 |
| Smeltpunt | 137-143℃ |
| Kookpunt | 305.8°C at 760 mmHg |
| Brekingsindex | 1.559 |
| Vlampunt | 138.7°C |
| Dampdruk | 0.000805mmHg at 25°C |
| Gevaarsymbolen |  T##Toxic:; |
| Risico-codes | R25##Toxic if swallowed.:; |
| Veiligheid Omschrijving | S28A##After contact with skin, wash immediately with plenty of water.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 70-69-9 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 