ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-hydroxy-3,5-diiodobenzoic acid |
|
Naam product | 4-hydroxy-3,5-diiodobenzoic acid |
Engelse naam | 4-hydroxy-3,5-diiodobenzoic acid;3,5-Diiodo-4-hydroxybenzoic acid |
MF | C7H4I2O3 |
Molecuulgewicht | 389.9138 |
InChI | InChI=1/C7H4I2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
CAS-nummer | 618-76-8 |
EINECS | 210-562-0 |
Moleculaire Structuur | |
Dichtheid | 2.697g/cm3 |
Kookpunt | 346.4°C at 760 mmHg |
Brekingsindex | 1.784 |
Vlampunt | 163.3°C |
Dampdruk | 2.19E-05mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |