ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-56-4 3,5-Diaminobenzoic acid dihydrochloride |
|
Naam product | 3,5-Diaminobenzoic acid dihydrochloride |
Engelse naam | 3,5-Diaminobenzoic acid dihydrochloride;Benzoic acid, 3,5-diamino-, hydrochloride (1:2);AI3-51087;NSC 57806;Benzoic acid, 3,5-diamino-, dihydrochloride |
MF | C7H8N2O2.2HCl |
Molecuulgewicht | 225.07 |
InChI | InChI=1/C7H8N2O2.2ClH/c8-5-1-4(7(10)11)2-6(9)3-5;;/h1-3H,8-9H2,(H,10,11);2*1H |
CAS-nummer | 618-56-4 |
EINECS | 210-556-8 |
Moleculaire Structuur | |
Smeltpunt | 300℃ |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |