Chemindex > 618-31-5
NL ▼
618-31-5 Alpha,Alpha-Dibromotoluene |
|
| Naam product | Alpha,Alpha-Dibromotoluene |
| Engelse naam | Alpha,Alpha-Dibromotoluene;Benzal bromide;(dibromomethyl)benzene |
| MF | C7H6Br2 |
| Molecuulgewicht | 249.9305 |
| InChI | InChI=1/C7H6Br2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| CAS-nummer | 618-31-5 |
| EINECS | 210-543-7 |
| Moleculaire Structuur |  |
| Dichtheid | 1.881g/cm3 |
| Kookpunt | 276.6°C at 760 mmHg |
| Brekingsindex | 1.619 |
| Vlampunt | 100.2°C |
| Dampdruk | 0.00802mmHg at 25°C |
| Gevaarsymbolen |  T##Toxic:; |
| Risico-codes | R23/24##Toxic by inhalation and in contact with skin.||R33##Danger of cummulative effects.:; |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 618-31-5 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 