ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-31-5 Alpha,Alpha-Dibromotoluene |
|
Naam product | Alpha,Alpha-Dibromotoluene |
Engelse naam | Alpha,Alpha-Dibromotoluene;Benzal bromide;(dibromomethyl)benzene |
MF | C7H6Br2 |
Molecuulgewicht | 249.9305 |
InChI | InChI=1/C7H6Br2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
CAS-nummer | 618-31-5 |
EINECS | 210-543-7 |
Moleculaire Structuur | |
Dichtheid | 1.881g/cm3 |
Kookpunt | 276.6°C at 760 mmHg |
Brekingsindex | 1.619 |
Vlampunt | 100.2°C |
Dampdruk | 0.00802mmHg at 25°C |
Gevaarsymbolen | T##Toxic:; |
Risico-codes | R23/24##Toxic by inhalation and in contact with skin.||R33##Danger of cummulative effects.:; |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |