ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Vanilicacidethylester; 97% |
|
Naam product | Vanilicacidethylester; 97% |
Engelse naam | Vanilicacidethylester; 97%;Vanilic acid ethyl ester;Ethyl vanillate;Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester;4-Hydroxy-3-methoxybenzoic acid ethyl ester;ethyl 4-hydroxy-3-methoxybenzoate |
MF | C10H12O4 |
Molecuulgewicht | 196.1999 |
InChI | InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
CAS-nummer | 617-05-0 |
EINECS | 210-503-9 |
Moleculaire Structuur | |
Dichtheid | 1.18g/cm3 |
Smeltpunt | 39-41℃ |
Kookpunt | 292°C at 760 mmHg |
Brekingsindex | 1.528 |
Vlampunt | 122.4°C |
Dampdruk | 0.00108mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |