Chemindex > 617-02-7
NL â–¼
617-02-7 o-Tolyl benzoate |
|
| Naam product | o-Tolyl benzoate |
| Engelse naam | o-Tolyl benzoate;o-Tolyl benzoate (Benzoic acid o-tolyl ester);Benzoic acid o-tolyl ester;2-methylphenyl benzoate |
| MF | C14H12O2 |
| Molecuulgewicht | 212.2439 |
| InChI | InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
| CAS-nummer | 617-02-7 |
| EINECS | 210-501-8 |
| Moleculaire Structuur |  |
| Dichtheid | 1.122g/cm3 |
| Kookpunt | 368.9°C at 760 mmHg |
| Brekingsindex | 1.577 |
| Vlampunt | 154.5°C |
| Dampdruk | 1.23E-05mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 617-02-7 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 