ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
614-34-6 P-tolylbenzoaat |
|
Naam product | P-tolylbenzoaat |
Synoniemen | ;p-tolylbenzoaat (benzoëzuur p-tolylester); Benzoëzuur p-tolylester; 4-methylfenylbenzoaat; |
Engelse naam | P-tolyl benzoate;p-Tolyl benzoate (Benzoic acid p-tolyl ester);Benzoic acid p-tolyl ester;4-methylphenyl benzoate |
MF | C14H12O2 |
Molecuulgewicht | 212.2439 |
InChI | InChI=1/C14H12O2/c1-11-7-9-13(10-8-11)16-14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
CAS-nummer | 614-34-6 |
EINECS | 210-380-1 |
Moleculaire Structuur | |
Dichtheid | 1.122g/cm3 |
Smeltpunt | 70-72℃ |
Kookpunt | 316.6°C at 760 mmHg |
Brekingsindex | 1.577 |
Vlampunt | 130.1°C |
Dampdruk | 0.000407mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |