ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-92-3 N'-hydroxybenzenecarboximidamide |
|
Naam product | N'-hydroxybenzenecarboximidamide |
Engelse naam | N'-hydroxybenzenecarboximidamide;Benzamidoxime;N-Hydroxy-Benzamidine |
MF | C7H8N2O |
Molecuulgewicht | 136.1512 |
InChI | InChI=1/C7H8N2O/c8-7(9-10)6-4-2-1-3-5-6/h1-5,10H,(H2,8,9) |
CAS-nummer | 613-92-3 |
EINECS | 210-361-8 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.18g/cm3 |
Smeltpunt | 60℃ |
Kookpunt | 307.4°C at 760 mmHg |
Brekingsindex | 1.574 |
Vlampunt | 139.7°C |
Dampdruk | 0.000315mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |