ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-54-7 alpha-Bromo-2'-acetonaphthone |
|
Naam product | alpha-Bromo-2'-acetonaphthone |
Engelse naam | alpha-Bromo-2'-acetonaphthone;Bromomethyl 2-naphthyl ketone;alpha-Bromo-2-acetonaphthone;2-(Bromoacetyl)naphthalene;2-(Bromoacetyl)naphthalene;2-bromo-1-(naphthalen-2-yl)ethanone;α-Bromo-2-acetonaphthone;2-Bromo-2'-acetonaphthone;2-Bromo-1-(2-naphthyl)-1-ethanone |
MF | C12H9BrO |
Molecuulgewicht | 249.1033 |
InChI | InChI=1/C12H9BrO/c13-8-12(14)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2 |
CAS-nummer | 613-54-7 |
EINECS | 210-348-7 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.48g/cm3 |
Smeltpunt | 82-85℃ |
Kookpunt | 349.8°C at 760 mmHg |
Brekingsindex | 1.656 |
Vlampunt | 99.1°C |
Dampdruk | 4.59E-05mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R34##Causes burns.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |