ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-31-0 9,10-Dihydroanthracene |
|
Naam product | 9,10-Dihydroanthracene |
Engelse naam | 9,10-Dihydroanthracene;AI3-09026;Anthracene, dihydro-;NSC 30805;Anthracene, 9,10-dihydro- |
MF | C14H12 |
Molecuulgewicht | 180.2451 |
InChI | InChI=1/C14H12/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-8H,9-10H2 |
CAS-nummer | 613-31-0 |
EINECS | 210-336-1 |
Moleculaire Structuur | |
Dichtheid | 1.085g/cm3 |
Smeltpunt | 104-107℃ |
Kookpunt | 305°C at 760 mmHg |
Brekingsindex | 1.62 |
Vlampunt | 131.8°C |
Dampdruk | 0.00152mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |